CAS 888073-10-7 is the registry number for 4-Amino-3,5-dichloro-2-(trifluoromethyl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3,5-dichloro-2-(trifluoromethyl)benzonitrile (CAS 888073-10-7) is a chemical compound with the molecular formula C8H3Cl2F3N2 and a molecular weight of 255.02 g/mol. IUPAC name: 4-amino-3,5-dichloro-2-(trifluoromethyl)benzonitrile. InChIKey: AVFJGMXUDPJZDK-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3N2 |
|---|---|
| Molecular weight | 255.02 g/mol |
| IUPAC name | 4-amino-3,5-dichloro-2-(trifluoromethyl)benzonitrile |
| InChIKey | AVFJGMXUDPJZDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)N)Cl)C(F)(F)F)C#N |
Computed by PubChem (NCBI)