CAS 2340293-72-1 is the registry number for 4-((3,3-Difluoropiperidin-1-yl)sulfonyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(3,3-difluoropiperidin-1-yl)sulfonylaniline (CAS 2340293-72-1) is a chemical compound with the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. IUPAC name: 4-(3,3-difluoropiperidin-1-yl)sulfonylaniline. InChIKey: LQZTTYLZONXMFF-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O2S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 4-(3,3-difluoropiperidin-1-yl)sulfonylaniline |
| InChIKey | LQZTTYLZONXMFF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)N)(F)F |
Computed by PubChem (NCBI)