CAS 352214-00-7 is the registry number for 1-((3,4-Difluorophenyl)sulfonyl)-4-methylpiperazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-difluorophenyl)sulfonyl-4-methylpiperazine (CAS 352214-00-7) is a chemical compound with the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. IUPAC name: 1-(3,4-difluorophenyl)sulfonyl-4-methylpiperazine. InChIKey: ZQFRCYHPLHPYRM-UHFFFAOYSA-N.
| Molecular formula | C11H14F2N2O2S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)sulfonyl-4-methylpiperazine |
| InChIKey | ZQFRCYHPLHPYRM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)