CAS 2342-67-8 appears in our catalog under these names: 3,3,3-Trifluoropropyl 4-methylbenzenesulfonate, 95%, 3,3,3–trifluoropropyl 4–methylbenzenesulfonate, 3,3,3-Trifluoropropyl 4-methylbenzenesulfonate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 2,5g.
3,3,3-trifluoropropyl 4-methylbenzenesulfonate (CAS 2342-67-8) is a chemical compound with the molecular formula C10H11F3O3S and a molecular weight of 268.25 g/mol. IUPAC name: 3,3,3-trifluoropropyl 4-methylbenzenesulfonate. InChIKey: XQTHZBKUIVFAST-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O3S |
|---|---|
| Molecular weight | 268.25 g/mol |
| IUPAC name | 3,3,3-trifluoropropyl 4-methylbenzenesulfonate |
| InChIKey | XQTHZBKUIVFAST-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC(F)(F)F |
Computed by PubChem (NCBI)