Products 98440-32-5

CAS 98440-32-5 is the registry number for 4-(Trifluoromethyl)phenethyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[4-(trifluoromethyl)phenyl]ethyl methanesulfonate (CAS 98440-32-5) is a chemical compound with the molecular formula C10H11F3O3S and a molecular weight of 268.25 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]ethyl methanesulfonate. InChIKey: SKUSNIXIBFEGSU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11F3O3S
Molecular weight268.25 g/mol
IUPAC name2-[4-(trifluoromethyl)phenyl]ethyl methanesulfonate
InChIKeySKUSNIXIBFEGSU-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCC1=CC=C(C=C1)C(F)(F)F

Computed by PubChem (NCBI)