CAS 2342596-64-7 is the registry number for rel-(3R,4S)-1-((Benzyloxy)carbonyl)-4-hydroxypiperidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 2342596-64-7) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3R,4S)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: DVFRBOFXJZNHMG-NEPJUHHUSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3R,4S)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | DVFRBOFXJZNHMG-NEPJUHHUSA-N |
| SMILES | C1CN(C[C@H]([C@H]1O)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)