Products 2922438-86-4
CAS 2922438-86-4 is the registry number for (3S,4R)-1-benzyloxycarbonyl-4-hydroxy-piperidine-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3S,4R)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 2922438-86-4) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3S,4R)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: DVFRBOFXJZNHMG-NWDGAFQWSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3S,4R)-4-hydroxy-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | DVFRBOFXJZNHMG-NWDGAFQWSA-N |
| SMILES | C1CN(C[C@@H]([C@@H]1O)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)