Products 2343963-90-4
CAS 2343963-90-4 is the registry number for rac-(1R,4S,5R,6S)-2,3-Diazabicyclo(2.2.1)heptane-5,6-diol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,4S,5R,6S)-2,3-diazabicyclo[2.2.1]heptane-5,6-diol;hydrochloride (CAS 2343963-90-4) is a chemical compound with the molecular formula C5H11ClN2O2 and a molecular weight of 166.60 g/mol. IUPAC name: (1R,4S,5R,6S)-2,3-diazabicyclo[2.2.1]heptane-5,6-diol;hydrochloride. InChIKey: ARGFTARHSCPQFR-YNURBZMNSA-N.
| Molecular formula | C5H11ClN2O2 |
|---|---|
| Molecular weight | 166.60 g/mol |
| IUPAC name | (1R,4S,5R,6S)-2,3-diazabicyclo[2.2.1]heptane-5,6-diol;hydrochloride |
| InChIKey | ARGFTARHSCPQFR-YNURBZMNSA-N |
| SMILES | C1[C@@H]2[C@@H]([C@@H]([C@H]1NN2)O)O.Cl |
Computed by PubChem (NCBI)