Products 2343964-00-9
CAS 2343964-00-9 is the registry number for rac-tert-Butyl (4aR,7aS)-octahydrofuro(3,4-b)pyridine-4a-carboxylate. Offered by: Biosynth. Available pack sizes: 10mg, 0,1g.
Tert-butyl (4aS,7aR)-2,3,4,5,7,7a-hexahydro-1H-furo[3,4-b]pyridine-4a-carboxylate (CAS 2343964-00-9) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (4aS,7aR)-2,3,4,5,7,7a-hexahydro-1H-furo[3,4-b]pyridine-4a-carboxylate. InChIKey: HYMCUSLRYVTGBT-JOYOIKCWSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (4aS,7aR)-2,3,4,5,7,7a-hexahydro-1H-furo[3,4-b]pyridine-4a-carboxylate |
| InChIKey | HYMCUSLRYVTGBT-JOYOIKCWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@]12CCCN[C@H]1COC2 |
Computed by PubChem (NCBI)