CAS 2344685-18-1 is the registry number for (5-(Azetidin-3-yl)-1,3-oxazol-4-yl)methanol dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-(azetidin-3-yl)-1,3-oxazol-4-yl]methanol;dihydrochloride (CAS 2344685-18-1) is a chemical compound with the molecular formula C7H12Cl2N2O2 and a molecular weight of 227.09 g/mol. IUPAC name: [5-(azetidin-3-yl)-1,3-oxazol-4-yl]methanol;dihydrochloride. InChIKey: DTLLIXRJIGMDTN-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | [5-(azetidin-3-yl)-1,3-oxazol-4-yl]methanol;dihydrochloride |
| InChIKey | DTLLIXRJIGMDTN-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=C(N=CO2)CO.Cl.Cl |
Computed by PubChem (NCBI)