Products 50503-42-9

CAS 50503-42-9 is the registry number for 4,6-Dimethoxypyridin-3-amine dihydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4,6-dimethoxypyridin-3-amine;dihydrochloride (CAS 50503-42-9) is a chemical compound with the molecular formula C7H12Cl2N2O2 and a molecular weight of 227.09 g/mol. IUPAC name: 4,6-dimethoxypyridin-3-amine;dihydrochloride. InChIKey: BDDBXMMGHYQMRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12Cl2N2O2
Molecular weight227.09 g/mol
IUPAC name4,6-dimethoxypyridin-3-amine;dihydrochloride
InChIKeyBDDBXMMGHYQMRQ-UHFFFAOYSA-N
SMILESCOC1=CC(=NC=C1N)OC.Cl.Cl

Computed by PubChem (NCBI)