CAS 2345666-26-2 appears in our catalog under these names: 1(R),2(S)–epoxy Cannabidiol, 1(R),2(S)-epoxy Cannabidiol, (1S,6R)-Cannabidiol Epoxide. Offered by: GLPBio, MedChemExpress, Chemat Brand. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg, on request.
2-[(1S,2R,3R,6R)-6-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]-5-pentylbenzene-1,3-diol (CAS 2345666-26-2) is a chemical compound with the molecular formula C21H30O3 and a molecular weight of 330.5 g/mol. IUPAC name: 2-[(1S,2R,3R,6R)-6-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]-5-pentylbenzene-1,3-diol. InChIKey: ZNMAVDDTVQRISH-DZLUEKEQSA-N.
| Molecular formula | C21H30O3 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 2-[(1S,2R,3R,6R)-6-methyl-3-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]-5-pentylbenzene-1,3-diol |
| InChIKey | ZNMAVDDTVQRISH-DZLUEKEQSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)[C@H]2[C@@H](CC[C@@]3([C@H]2O3)C)C(=C)C)O |
Computed by PubChem (NCBI)