Products 2346499-26-9
CAS 2346499-26-9 is the registry number for 4-((2-Cyanopropan-2-yl)amino)-N-methylbenzamide, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-(2-cyanopropan-2-ylamino)-N-methylbenzamide (CAS 2346499-26-9) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 4-(2-cyanopropan-2-ylamino)-N-methylbenzamide. InChIKey: SEHJJQFLRLRNPO-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 4-(2-cyanopropan-2-ylamino)-N-methylbenzamide |
| InChIKey | SEHJJQFLRLRNPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)NC1=CC=C(C=C1)C(=O)NC |
Computed by PubChem (NCBI)