Products 23485-68-9
CAS 23485-68-9 is the registry number for 3-(5-Phenyl-1,3-oxazol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid (CAS 23485-68-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid. InChIKey: GFVIYHMHRMUSLA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid |
| InChIKey | GFVIYHMHRMUSLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid, 2-oxazolepropanoic acid, 5-phenyl-, 3-(5-Phenyloxazol-2-yl)propanoic acid, 3-(5-Phenyl-oxazol-2-yl)-propionic acid, 2-Oxazolepropanoicacid, 5-phenyl-, orb3026155, 5-Phenyl-oxazole-2-propanoic acid, 3-(5-Phenyloxazol-2-yl)propanoicacid, 3-(5-Phenyl-2-oxazolyl)propanoic Acid, 5-Phenyloxazole-2-propionic acid, 97%