Products 2349316-26-1

CAS 2349316-26-1 is the registry number for Fmoc-D-Phe(3-NHAc)-OH 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-3-(3-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2349316-26-1) is a chemical compound with the molecular formula C26H24N2O5 and a molecular weight of 444.5 g/mol. IUPAC name: (2R)-3-(3-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QZHDVHBQMQHYFY-XMMPIXPASA-N.

Identity
Molecular formulaC26H24N2O5
Molecular weight444.5 g/mol
IUPAC name(2R)-3-(3-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
InChIKeyQZHDVHBQMQHYFY-XMMPIXPASA-N
SMILESCC(=O)NC1=CC=CC(=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)