CAS 2973755-14-3 is the registry number for Fmoc-4-(2-amino-2-oxoethyl)-L-phenylalanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-[4-(2-amino-2-oxoethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2973755-14-3) is a chemical compound with the molecular formula C26H24N2O5 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-3-[4-(2-amino-2-oxoethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CXHPSHFZOXEXKO-QHCPKHFHSA-N.
| Molecular formula | C26H24N2O5 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-3-[4-(2-amino-2-oxoethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CXHPSHFZOXEXKO-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)