CAS 1217801-44-9 appears in our catalog under these names: Fmoc-D-Phe(4-NHAc)-OH 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-acetamidophenyl)propanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
(2R)-3-(4-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1217801-44-9) is a chemical compound with the molecular formula C26H24N2O5 and a molecular weight of 444.5 g/mol. IUPAC name: (2R)-3-(4-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: OJDKWDQVBLTUAW-XMMPIXPASA-N.
| Molecular formula | C26H24N2O5 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2R)-3-(4-acetamidophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | OJDKWDQVBLTUAW-XMMPIXPASA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)