Products 2349373-70-0
CAS 2349373-70-0 is the registry number for CCG-232964. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[5-(2-chloro-4-cyclopropylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid (CAS 2349373-70-0) is a chemical compound with the molecular formula C15H15ClN2O3S and a molecular weight of 338.8 g/mol. IUPAC name: 4-[[5-(2-chloro-4-cyclopropylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid. InChIKey: AKQOOCVXRXDGNN-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O3S |
|---|---|
| Molecular weight | 338.8 g/mol |
| IUPAC name | 4-[[5-(2-chloro-4-cyclopropylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
| InChIKey | AKQOOCVXRXDGNN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C3=NN=C(O3)SCCCC(=O)O)Cl |
Computed by PubChem (NCBI)