Products 97437-97-3
CAS 97437-97-3 appears in our catalog under these names: 4–Chloro–N–(2，5–dimethylphenyl)–3–sulfamoylbenzamide, 4-Chloro-N-(2,5-dimethylphenyl)-3-sulfamoylbenzamide, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-chloro-N-(2,5-dimethylphenyl)-3-sulfamoylbenzamide (CAS 97437-97-3) is a chemical compound with the molecular formula C15H15ClN2O3S and a molecular weight of 338.8 g/mol. IUPAC name: 4-chloro-N-(2,5-dimethylphenyl)-3-sulfamoylbenzamide. InChIKey: ZYADNDOMPSFJLJ-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O3S |
|---|---|
| Molecular weight | 338.8 g/mol |
| IUPAC name | 4-chloro-N-(2,5-dimethylphenyl)-3-sulfamoylbenzamide |
| InChIKey | ZYADNDOMPSFJLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)