CAS 2349414-30-6 is the registry number for O-Methyl (S)-Noradrenaline. Offered by: TRC. Available pack sizes: 250mg.
4-[(1S)-2-amino-1-methoxyethyl]benzene-1,2-diol (CAS 2349414-30-6) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 4-[(1S)-2-amino-1-methoxyethyl]benzene-1,2-diol. InChIKey: LNPKPYXTDNJNAQ-SECBINFHSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 4-[(1S)-2-amino-1-methoxyethyl]benzene-1,2-diol |
| InChIKey | LNPKPYXTDNJNAQ-SECBINFHSA-N |
| SMILES | CO[C@H](CN)C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)