CAS 2349961-66-4 appears in our catalog under these names: (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(3,5-difluorophenyl)butanoic acid, 97%, 97%, Fmoc-R-3-amino-4-(3,5-difluorophenyl)-butyric acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-4-(3,5-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 2349961-66-4) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (3R)-4-(3,5-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: FDRZOMBFYOMDNR-GOSISDBHSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (3R)-4-(3,5-difluorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | FDRZOMBFYOMDNR-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC(=C4)F)F)CC(=O)O |
Computed by PubChem (NCBI)