Products 2350456-26-5
CAS 2350456-26-5 is the registry number for N-Fmoc-2-fluoro-5-hydroxy-L-phenylalanine, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluoro-5-hydroxyphenyl)propanoic acid (CAS 2350456-26-5) is a chemical compound with the molecular formula C24H20FNO5 and a molecular weight of 421.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluoro-5-hydroxyphenyl)propanoic acid. InChIKey: NCQINFRLKGJNQT-QFIPXVFZSA-N.
| Molecular formula | C24H20FNO5 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-fluoro-5-hydroxyphenyl)propanoic acid |
| InChIKey | NCQINFRLKGJNQT-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C=CC(=C4)O)F)C(=O)O |
Computed by PubChem (NCBI)