Products 2350734-56-2
CAS 2350734-56-2 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2,3-dimethylphenyl)butanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-4-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 2350734-56-2) is a chemical compound with the molecular formula C27H27NO4 and a molecular weight of 429.5 g/mol. IUPAC name: (2S)-4-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: KGJQUZQLZWPDPY-VWLOTQADSA-N.
| Molecular formula | C27H27NO4 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | (2S)-4-(2,3-dimethylphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | KGJQUZQLZWPDPY-VWLOTQADSA-N |
| SMILES | CC1=C(C(=CC=C1)CC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)