CAS 2490159-62-9 is the registry number for N-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-methyl-L-phenylalanine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-(4-methylphenyl)propanoic acid (CAS 2490159-62-9) is a chemical compound with the molecular formula C27H27NO4 and a molecular weight of 429.5 g/mol. IUPAC name: (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-(4-methylphenyl)propanoic acid. InChIKey: CZMWSWHQFZWAHZ-VWLOTQADSA-N.
| Molecular formula | C27H27NO4 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-(4-methylphenyl)propanoic acid |
| InChIKey | CZMWSWHQFZWAHZ-VWLOTQADSA-N |
| SMILES | CCN([C@@H](CC1=CC=C(C=C1)C)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)