Products 2351002-30-5
CAS 2351002-30-5 is the registry number for trans-tert-butyl 3-amino-4-(pyridin-2-yl)pyrrolidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3R,4S)-3-amino-4-pyridin-2-ylpyrrolidine-1-carboxylate (CAS 2351002-30-5) is a chemical compound with the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. IUPAC name: tert-butyl (3R,4S)-3-amino-4-pyridin-2-ylpyrrolidine-1-carboxylate. InChIKey: NSRDBKHRNAGFAZ-QWRGUYRKSA-N.
| Molecular formula | C14H21N3O2 |
|---|---|
| Molecular weight | 263.34 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-amino-4-pyridin-2-ylpyrrolidine-1-carboxylate |
| InChIKey | NSRDBKHRNAGFAZ-QWRGUYRKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)N)C2=CC=CC=N2 |
Computed by PubChem (NCBI)