CAS 2351820-19-2 appears in our catalog under these names: (±)–trans–GK563, GK563, GK 563. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, Get quote.
(3R,4R)-3-(4-phenylbutyl)-4-propyloxetan-2-one (CAS 2351820-19-2) is a chemical compound with the molecular formula C16H22O2 and a molecular weight of 246.34 g/mol. IUPAC name: (3R,4R)-3-(4-phenylbutyl)-4-propyloxetan-2-one. InChIKey: IAYKBJFWLAKGMR-HUUCEWRRSA-N.
| Molecular formula | C16H22O2 |
|---|---|
| Molecular weight | 246.34 g/mol |
| IUPAC name | (3R,4R)-3-(4-phenylbutyl)-4-propyloxetan-2-one |
| InChIKey | IAYKBJFWLAKGMR-HUUCEWRRSA-N |
| SMILES | CCC[C@@H]1[C@H](C(=O)O1)CCCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)