Products 2351898-91-2
CAS 2351898-91-2 appears in our catalog under these names: 8pyDTZ, 8pyDTZ, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 25mg, 10mg, 50mg, 5 mg, 50 mg, 10 mg.
2-benzyl-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol (CAS 2351898-91-2) is a chemical compound with the molecular formula C24H18N4O and a molecular weight of 378.4 g/mol. IUPAC name: 2-benzyl-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol. InChIKey: UVOHXMHJSGTOSY-UHFFFAOYSA-N.
| Molecular formula | C24H18N4O |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-benzyl-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol |
| InChIKey | UVOHXMHJSGTOSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N3C=C(N=C(C3=N2)C4=CC=NC=C4)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)