CAS 871507-11-8 is the registry number for Mardepodect precursor. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenoxy]methyl]quinoline (CAS 871507-11-8) is a chemical compound with the molecular formula C24H18N4O and a molecular weight of 378.4 g/mol. IUPAC name: 2-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenoxy]methyl]quinoline. InChIKey: VRWJZGHUCOFGPZ-UHFFFAOYSA-N.
| Molecular formula | C24H18N4O |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)phenoxy]methyl]quinoline |
| InChIKey | VRWJZGHUCOFGPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)COC3=CC=C(C=C3)C4=C(C=NN4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)