Products 2352949-41-6
CAS 2352949-41-6 is the registry number for 3-(3,5-Bis(trifluoromethyl)phenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxypropanoic acid (CAS 2352949-41-6) is a chemical compound with the molecular formula C11H8F6O3 and a molecular weight of 302.17 g/mol. IUPAC name: 3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxypropanoic acid. InChIKey: XWKDMZQYQGSVIX-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O3 |
|---|---|
| Molecular weight | 302.17 g/mol |
| IUPAC name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxypropanoic acid |
| InChIKey | XWKDMZQYQGSVIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(C(=O)O)O |
Computed by PubChem (NCBI)