CAS 291535-28-9 is the registry number for 4-(1,1,2,3,3,3-Hexafluoropropoxy)-3-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxybenzaldehyde (CAS 291535-28-9) is a chemical compound with the molecular formula C11H8F6O3 and a molecular weight of 302.17 g/mol. IUPAC name: 4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxybenzaldehyde. InChIKey: FZMNFSWNVPKBFJ-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O3 |
|---|---|
| Molecular weight | 302.17 g/mol |
| IUPAC name | 4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxybenzaldehyde |
| InChIKey | FZMNFSWNVPKBFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)