CAS 2353115-00-9 is the registry number for (3-Chloro-2,6-difluorophenyl)cyclopropylmethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3-chloro-2,6-difluorophenyl)-cyclopropylmethanone (CAS 2353115-00-9) is a chemical compound with the molecular formula C10H7ClF2O and a molecular weight of 216.61 g/mol. IUPAC name: (3-chloro-2,6-difluorophenyl)-cyclopropylmethanone. InChIKey: LZWVJQUNDOCGDN-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF2O |
|---|---|
| Molecular weight | 216.61 g/mol |
| IUPAC name | (3-chloro-2,6-difluorophenyl)-cyclopropylmethanone |
| InChIKey | LZWVJQUNDOCGDN-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=CC(=C2F)Cl)F |
Computed by PubChem (NCBI)