CAS 2353190-33-5 appears in our catalog under these names: Losartan Impurity 25, Losartan Impurity 26. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(azidomethyl)-2-butyl-4-chloro-1H-imidazole (CAS 2353190-33-5) is a chemical compound with the molecular formula C8H12ClN5 and a molecular weight of 213.67 g/mol. IUPAC name: 5-(azidomethyl)-2-butyl-4-chloro-1H-imidazole. InChIKey: DMEADVQYNIZADO-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN5 |
|---|---|
| Molecular weight | 213.67 g/mol |
| IUPAC name | 5-(azidomethyl)-2-butyl-4-chloro-1H-imidazole |
| InChIKey | DMEADVQYNIZADO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1)CN=[N+]=[N-])Cl |
Computed by PubChem (NCBI)