Products 55-57-2
CAS 55-57-2 appears in our catalog under these names: 1-Phenylbiguanide hydrochloride, 98%, 1-Phenylbiguanide hydrochloride, >95% (HPLC), 1-Phenylbiguanide HCl/ 98%, 1–Phenylbiguanide hydrochloride, 1-Phenylbiguanide hydrochloride. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g, 100mg, 250mg, 100g, 100 g.
1-(diaminomethylidene)-2-phenylguanidine;hydrochloride (CAS 55-57-2) is a chemical compound with the molecular formula C8H12ClN5 and a molecular weight of 213.67 g/mol. IUPAC name: 1-(diaminomethylidene)-2-phenylguanidine;hydrochloride. InChIKey: FHUDRDSKZQDCBC-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN5 |
|---|---|
| Molecular weight | 213.67 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-phenylguanidine;hydrochloride |
| InChIKey | FHUDRDSKZQDCBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C(N)N=C(N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Phenylbiguanide monohydrochloride, N-Phenylimidodicarbonimidic diamide hydrochloride, Phenylbiguanide hydrochloride, Phenyldiguanide hydrochloride, 1-Phenylbiquanide hydrochloride, Phenylbiguanide monohydrochloride, N'-Phenylbiguanide monohydrochloride, Phenylbiguanide (hydrochloride), 1-carbamimidamido-N-phenylmethanimidamide hydrochloride, Imidodicarbonimidic diamide, N-phenyl-, monohydrochloride