CAS 2355-16-0 appears in our catalog under these names: 2-Amino-4-[(trifluoromethyl)sulfonyl]phenylamine, 95%, 4-((Trifluoromethyl)sulfonyl)benzene-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-(trifluoromethylsulfonyl)benzene-1,2-diamine (CAS 2355-16-0) is a chemical compound with the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. IUPAC name: 4-(trifluoromethylsulfonyl)benzene-1,2-diamine. InChIKey: XHTLLPJFZIYMHD-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2S |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 4-(trifluoromethylsulfonyl)benzene-1,2-diamine |
| InChIKey | XHTLLPJFZIYMHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)C(F)(F)F)N)N |
Computed by PubChem (NCBI)