CAS 53718-45-9 appears in our catalog under these names: N-(2-Aminophenyl)-1,1,1-trifluoromethanesulfonamide, 95%, N-(2-Aminophenyl)-1,1,1-trifluoromethanesulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-(2-aminophenyl)-1,1,1-trifluoromethanesulfonamide (CAS 53718-45-9) is a chemical compound with the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. IUPAC name: N-(2-aminophenyl)-1,1,1-trifluoromethanesulfonamide. InChIKey: DPYOORODQNBACJ-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2S |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | N-(2-aminophenyl)-1,1,1-trifluoromethanesulfonamide |
| InChIKey | DPYOORODQNBACJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)