CAS 23567-05-7 is the registry number for (1R,2R,3S,4R,5R)-6,8-Dioxabicyclo[3.2.1]octane-2,3,4-triyl tribenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2R,3S,4R,5R)-3,4-dibenzoyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] benzoate (CAS 23567-05-7) is a chemical compound with the molecular formula C27H22O8 and a molecular weight of 474.5 g/mol. IUPAC name: [(1R,2R,3S,4R,5R)-3,4-dibenzoyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] benzoate. InChIKey: PUALUCOESOGESO-GWQOTCSHSA-N.
| Molecular formula | C27H22O8 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | [(1R,2R,3S,4R,5R)-3,4-dibenzoyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] benzoate |
| InChIKey | PUALUCOESOGESO-GWQOTCSHSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O1)O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)