CAS 93635-77-9 is the registry number for (3S,4R,5R)-5-((Benzoyloxy)methyl)-3-methyl-2-oxotetrahydrofuran-3,4-diyl dibenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S)-3,4-dibenzoyloxy-4-methyl-5-oxooxolan-2-yl]methyl benzoate (CAS 93635-77-9) is a chemical compound with the molecular formula C27H22O8 and a molecular weight of 474.5 g/mol. IUPAC name: [(2R,3R,4S)-3,4-dibenzoyloxy-4-methyl-5-oxooxolan-2-yl]methyl benzoate. InChIKey: KOELERLPRQKGLG-LOYIFYEOSA-N.
| Molecular formula | C27H22O8 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | [(2R,3R,4S)-3,4-dibenzoyloxy-4-methyl-5-oxooxolan-2-yl]methyl benzoate |
| InChIKey | KOELERLPRQKGLG-LOYIFYEOSA-N |
| SMILES | C[C@@]1([C@@H]([C@H](OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)