CAS 2357209-42-6 is the registry number for Levocabastine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3S,4R)-3-methyl-4-phenylpiperidine-4-carboxylate (CAS 2357209-42-6) is a chemical compound with the molecular formula C20H23NO2 and a molecular weight of 309.4 g/mol. IUPAC name: benzyl (3S,4R)-3-methyl-4-phenylpiperidine-4-carboxylate. InChIKey: JHAQCDVSKFELGB-OXQOHEQNSA-N.
| Molecular formula | C20H23NO2 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | benzyl (3S,4R)-3-methyl-4-phenylpiperidine-4-carboxylate |
| InChIKey | JHAQCDVSKFELGB-OXQOHEQNSA-N |
| SMILES | C[C@@H]1CNCC[C@@]1(C2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)