Products 898547-79-0
CAS 898547-79-0 is the registry number for (3R,4S)-Methyl 1-benzyl-4-p-tolylpyrrolidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (3R,4S)-1-benzyl-4-(4-methylphenyl)pyrrolidine-3-carboxylate (CAS 898547-79-0) is a chemical compound with the molecular formula C20H23NO2 and a molecular weight of 309.4 g/mol. IUPAC name: methyl (3R,4S)-1-benzyl-4-(4-methylphenyl)pyrrolidine-3-carboxylate. InChIKey: OIAPTMMHPMAUSD-MOPGFXCFSA-N.
| Molecular formula | C20H23NO2 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | methyl (3R,4S)-1-benzyl-4-(4-methylphenyl)pyrrolidine-3-carboxylate |
| InChIKey | OIAPTMMHPMAUSD-MOPGFXCFSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]2CN(C[C@@H]2C(=O)OC)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)