Products 2358775-67-2
CAS 2358775-67-2 appears in our catalog under these names: Bis-PEG1-C-PEG1-CH2COOH, 3,9,12,18-Tetraoxaicosanedioic acid, 95%, 95%, Bis-PEG1-C-PEG1-CH2COOH, 95.0%, Bis-PEG1-C-PEG1-CH2COOH, 95%. Offered by: TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
2-[5-[2-[5-(carboxymethoxy)pentoxy]ethoxy]pentoxy]acetic acid (CAS 2358775-67-2) is a chemical compound with the molecular formula C16H30O8 and a molecular weight of 350.40 g/mol. IUPAC name: 2-[5-[2-[5-(carboxymethoxy)pentoxy]ethoxy]pentoxy]acetic acid. InChIKey: OAISFDJULXOPPD-UHFFFAOYSA-N.
| Molecular formula | C16H30O8 |
|---|---|
| Molecular weight | 350.40 g/mol |
| IUPAC name | 2-[5-[2-[5-(carboxymethoxy)pentoxy]ethoxy]pentoxy]acetic acid |
| InChIKey | OAISFDJULXOPPD-UHFFFAOYSA-N |
| SMILES | C(CCOCCOCCCCCOCC(=O)O)CCOCC(=O)O |
Computed by PubChem (NCBI)