Products 2358849-47-3
CAS 2358849-47-3 is the registry number for COX-1/2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-bromo-2-(4-chlorophenyl)-4-methyl-3-oxidoquinazolin-3-ium (CAS 2358849-47-3) is a chemical compound with the molecular formula C15H10BrClN2O and a molecular weight of 349.61 g/mol. IUPAC name: 6-bromo-2-(4-chlorophenyl)-4-methyl-3-oxidoquinazolin-3-ium. InChIKey: RHVOYKDHVFHENK-UHFFFAOYSA-N.
| Molecular formula | C15H10BrClN2O |
|---|---|
| Molecular weight | 349.61 g/mol |
| IUPAC name | 6-bromo-2-(4-chlorophenyl)-4-methyl-3-oxidoquinazolin-3-ium |
| InChIKey | RHVOYKDHVFHENK-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NC(=[N+]1[O-])C3=CC=C(C=C3)Cl)Br |
Computed by PubChem (NCBI)