Products 23589-77-7
CAS 23589-77-7 is the registry number for HT1042. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3-nitrophenyl)-1,3,4-oxathiazol-2-one (CAS 23589-77-7) is a chemical compound with the molecular formula C8H4N2O4S and a molecular weight of 224.20 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,3,4-oxathiazol-2-one. InChIKey: QBAZATRGWRVUFN-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4S |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1,3,4-oxathiazol-2-one |
| InChIKey | QBAZATRGWRVUFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NSC(=O)O2 |
Computed by PubChem (NCBI)