CAS 23613-32-3 appears in our catalog under these names: 3,7-Dibenzothiophenedicarboxylic acid, 5,5-dioxide, 95%, 5,5–Dioxo–5H–dibenzo(b,d)thiophene–3,7–dicarboxylic acid, 5,5-Dioxo-5H-dibenzo[b,d]thiophene-3,7-dicarboxylic Acid, 90%, 90%, 5,5-Dioxo-5H-dibenzo[b,d]thiophene-3,7-dicarboxylic acid, 95%, Dibenzo[b,d]thiophene-3,7-dicarboxylic acid 5,5-dioxide, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
5,5-dioxodibenzothiophene-3,7-dicarboxylic acid (CAS 23613-32-3) is a chemical compound with the molecular formula C14H8O6S and a molecular weight of 304.28 g/mol. IUPAC name: 5,5-dioxodibenzothiophene-3,7-dicarboxylic acid. InChIKey: VDTYKOULMJJKGX-UHFFFAOYSA-N.
| Molecular formula | C14H8O6S |
|---|---|
| Molecular weight | 304.28 g/mol |
| IUPAC name | 5,5-dioxodibenzothiophene-3,7-dicarboxylic acid |
| InChIKey | VDTYKOULMJJKGX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)S(=O)(=O)C3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)