CAS 56670-83-8 appears in our catalog under these names: 1-Hydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid, 95%, 1-Hydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic Acid, ≥95%, ≥95%, 1-HYDROXY-9,10-DIOXO-9,10-DIHYDROANTHRACENE-2-SULFONIC ACID, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
1-hydroxy-9,10-dioxoanthracene-2-sulfonic acid (CAS 56670-83-8) is a chemical compound with the molecular formula C14H8O6S and a molecular weight of 304.28 g/mol. IUPAC name: 1-hydroxy-9,10-dioxoanthracene-2-sulfonic acid. InChIKey: OAJSTIHCWHYVKO-UHFFFAOYSA-N.
| Molecular formula | C14H8O6S |
|---|---|
| Molecular weight | 304.28 g/mol |
| IUPAC name | 1-hydroxy-9,10-dioxoanthracene-2-sulfonic acid |
| InChIKey | OAJSTIHCWHYVKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)S(=O)(=O)O)O |
Computed by PubChem (NCBI)