CAS 2361524-76-5 is the registry number for Phosphatase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R)-6,7-difluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (CAS 2361524-76-5) is a chemical compound with the molecular formula C12H12F2N2 and a molecular weight of 222.23 g/mol. IUPAC name: (1R)-6,7-difluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine. InChIKey: MVJHTYJTQAZZJL-SNVBAGLBSA-N.
| Molecular formula | C12H12F2N2 |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | (1R)-6,7-difluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| InChIKey | MVJHTYJTQAZZJL-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=C(C1)C3=CC(=C(C=C3N2)F)F)N |
Computed by PubChem (NCBI)