CAS 2408686-87-1 is the registry number for (S)-6,9-Difluoro-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-6,9-difluoro-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 2408686-87-1) is a chemical compound with the molecular formula C12H12F2N2 and a molecular weight of 222.23 g/mol. IUPAC name: (3S)-6,9-difluoro-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: YONGIKLVTFWGMA-LURJTMIESA-N.
| Molecular formula | C12H12F2N2 |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | (3S)-6,9-difluoro-3-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | YONGIKLVTFWGMA-LURJTMIESA-N |
| SMILES | C[C@H]1CC2=C(CN1)C3=C(C=CC(=C3N2)F)F |
Computed by PubChem (NCBI)