CAS 2361608-69-5 is the registry number for tert-Butyl N-((2S,3R)-3-amino-1-hydroxybutan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate (CAS 2361608-69-5) is a chemical compound with the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. IUPAC name: tert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate. InChIKey: LIVUZRASEMVBNR-RNFRBKRXSA-N.
| Molecular formula | C9H20N2O3 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | tert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate |
| InChIKey | LIVUZRASEMVBNR-RNFRBKRXSA-N |
| SMILES | C[C@H]([C@@H](CO)NC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)