Products 2361608-69-5

CAS 2361608-69-5 is the registry number for tert-Butyl N-((2S,3R)-3-amino-1-hydroxybutan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate (CAS 2361608-69-5) is a chemical compound with the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. IUPAC name: tert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate. InChIKey: LIVUZRASEMVBNR-RNFRBKRXSA-N.

Identity
Molecular formulaC9H20N2O3
Molecular weight204.27 g/mol
IUPAC nametert-butyl N-[(2S,3R)-3-amino-1-hydroxybutan-2-yl]carbamate
InChIKeyLIVUZRASEMVBNR-RNFRBKRXSA-N
SMILESC[C@H]([C@@H](CO)NC(=O)OC(C)(C)C)N

Computed by PubChem (NCBI)