Products 743449-09-4
CAS 743449-09-4 appears in our catalog under these names: Propamocarb-N-oxide, Propamocarb N-oxide, Propamocarb N-oxide, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 500mg, 50mg, 25mg, 1x25mg, 1x1ml.
N,N-dimethyl-3-(propoxycarbonylamino)propan-1-amine oxide (CAS 743449-09-4) is a chemical compound with the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. IUPAC name: N,N-dimethyl-3-(propoxycarbonylamino)propan-1-amine oxide. InChIKey: RHYOZHJMMSHYAZ-UHFFFAOYSA-N.
| Molecular formula | C9H20N2O3 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | N,N-dimethyl-3-(propoxycarbonylamino)propan-1-amine oxide |
| InChIKey | RHYOZHJMMSHYAZ-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)NCCC[N+](C)(C)[O-] |
Computed by PubChem (NCBI)