Products 2361634-43-5

CAS 2361634-43-5 is the registry number for Methyl 2-azaspiro(3.3)heptane-6-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride (CAS 2361634-43-5) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride. InChIKey: BRRUQJDMHNXPHP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC namemethyl 2-azaspiro[3.3]heptane-6-carboxylate;hydrochloride
InChIKeyBRRUQJDMHNXPHP-UHFFFAOYSA-N
SMILESCOC(=O)C1CC2(C1)CNC2.Cl

Computed by PubChem (NCBI)