Products 2361645-48-7
CAS 2361645-48-7 is the registry number for N2,N2-Dimethyl-(1,3)thiazolo(4,5-d)pyrimidine-2,7-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-N,2-N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine (CAS 2361645-48-7) is a chemical compound with the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. IUPAC name: 2-N,2-N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine. InChIKey: AVXXHLHBRIGHEY-UHFFFAOYSA-N.
| Molecular formula | C7H9N5S |
|---|---|
| Molecular weight | 195.25 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine |
| InChIKey | AVXXHLHBRIGHEY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=NC=NC(=C2S1)N |
Computed by PubChem (NCBI)